About 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one
4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one (PubChem CID 10714219) has the molecular formula C21H23FN2O3
and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one |
| PubChem CID | 10714219 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one |
| SMILES | CN(CCCC(=O)c1ccc(F)cc1)CCOc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C21H23FN2O3/c1-24(11-3-5-19(25)15-7-9-16(22)10-8-15)12-13-27-20-6-2-4-18-17(20)14-21(26)23-18/h2,4,6-10H,3,5,11-14H2,1H3,(H,23,26) |
| InChIKey | IOVXZPKVVVPHDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one?
The IUPAC name of 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one (CID 10714219) is 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one.
What is the SMILES notation for 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one?
The canonical SMILES for 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one is CN(CCCC(=O)c1ccc(F)cc1)CCOc1cccc2c1CC(=O)N2.
What is the InChIKey of 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one?
The InChIKey is IOVXZPKVVVPHDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O3/c1-24(11-3-5-19(25)15-7-9-16(22)10-8-15)12-13-27-20-6-2-4-18-17(20)14-21(26)23-18/h2,4,6-10H,3,5,11-14H2,1H3,(H,23,26).
What are the key properties of 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one?
4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one has a molecular weight of 370.42 g/mol, XLogP of 3.29, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[4-(4-fluorophenyl)-4-oxobutyl]-methylamino]ethoxy]-1,3-dihydroindol-2-one is sourced from PubChem (CID 10714219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).