C13H15F3N2O2 — CID 107142631
2-[3-[[2-(trifluoromethyl)phenyl]methylamino]azetidin-3-yl]acetic acid (PubChem CID 107142631) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-[3-[[2-(trifluoromethyl)phenyl]methylamino]azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-[[2-(trifluoromethyl)phenyl]methylamino]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107142631 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[3-[[2-(trifluoromethyl)phenyl]methylamino]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(NCc2ccccc2C(F)(F)F)CNC1 |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)10-4-2-1-3-9(10)6-18-12(5-11(19)20)7-17-8-12/h1-4,17-18H,5-8H2,(H,19,20) |
| InChIKey | GVQIQHQCVLBHCN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |