About 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene
1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene (PubChem CID 10714265) has the molecular formula C22H27Br
and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene.
Molecular Properties
| Compound Name | 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene |
| PubChem CID | 10714265 |
| Molecular Formula | C22H27Br |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene |
| SMILES | CC(C)(C)c1cc(/C=C\c2ccccc2Br)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H27Br/c1-21(2,3)18-13-16(14-19(15-18)22(4,5)6)11-12-17-9-7-8-10-20(17)23/h7-15H,1-6H3/b12-11- |
| InChIKey | CIZUNYLALOJKKY-QXMHVHEDSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene?
The IUPAC name of 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene (CID 10714265) is 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene.
What is the SMILES notation for 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene?
The canonical SMILES for 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene is CC(C)(C)c1cc(/C=C\c2ccccc2Br)cc(C(C)(C)C)c1.
What is the InChIKey of 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene?
The InChIKey is CIZUNYLALOJKKY-QXMHVHEDSA-N. The full InChI is InChI=1S/C22H27Br/c1-21(2,3)18-13-16(14-19(15-18)22(4,5)6)11-12-17-9-7-8-10-20(17)23/h7-15H,1-6H3/b12-11-.
What are the key properties of 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene?
1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene has a molecular weight of 371.36 g/mol, XLogP of 7.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-(2-bromophenyl)ethenyl]-3,5-ditert-butylbenzene is sourced from PubChem (CID 10714265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).