C9H18N2O2S — CID 107143102
2-[3-(2-methylsulfanylpropylamino)azetidin-3-yl]acetic acid (PubChem CID 107143102) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[3-(2-methylsulfanylpropylamino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(2-methylsulfanylpropylamino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107143102 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[3-(2-methylsulfanylpropylamino)azetidin-3-yl]acetic acid |
| SMILES | CSC(C)CNC1(CC(=O)O)CNC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-7(14-2)4-11-9(3-8(12)13)5-10-6-9/h7,10-11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | JAUZMBKVUNEGRQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |