C15H26N2O4S — CID 107143162
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(thian-4-ylamino)azetidin-3-yl]acetic acid (PubChem CID 107143162) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(thian-4-ylamino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(thian-4-ylamino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107143162 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(thian-4-ylamino)azetidin-3-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(=O)O)(NC2CCSCC2)C1 |
| InChI | InChI=1S/C15H26N2O4S/c1-14(2,3)21-13(20)17-9-15(10-17,8-12(18)19)16-11-4-6-22-7-5-11/h11,16H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | IQPVMIACYTUKIK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |