C19H36O5Si — CID 10714355
(4R,4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-(hydroxymethyl)-5-methoxy-2,2-dimethyl-4,5,8,8a-tetrahydro-3H-chromen-4-ol (PubChem CID 10714355) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (4R,4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-(hydroxymethyl)-5-methoxy-2,2-dimethyl-4,5,8,8a-tetrahydro-3H-chromen-4-ol.
| Compound Name | (4R,4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-(hydroxymethyl)-5-methoxy-2,2-dimethyl-4,5,8,8a-tetrahydro-3H-chromen-4-ol |
|---|---|
| PubChem CID | 10714355 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (4R,4aR,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-(hydroxymethyl)-5-methoxy-2,2-dimethyl-4,5,8,8a-tetrahydro-3H-chromen-4-ol |
| SMILES | CO[C@H]1C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)C[C@@H](O)[C@@]12CO |
| InChI | InChI=1S/C19H36O5Si/c1-17(2,3)25(7,8)24-13-9-15(22-6)19(12-20)14(21)11-18(4,5)23-16(19)10-13/h9,14-16,20-21H,10-12H2,1-8H3/t14-,15+,16-,19+/m1/s1 |
| InChIKey | ZIKWECKCAJXMDG-OLMMMNRUSA-N |
| XLogP | 3.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|