C24H23NOS — CID 10714408
N-(benzenecarbonothioyl)-2,2-diphenyl-N-propan-2-ylacetamide (PubChem CID 10714408) has the molecular formula C24H23NOS and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(benzenecarbonothioyl)-2,2-diphenyl-N-propan-2-ylacetamide.
| Compound Name | N-(benzenecarbonothioyl)-2,2-diphenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 10714408 |
| Molecular Formula | C24H23NOS |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(benzenecarbonothioyl)-2,2-diphenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)C(c1ccccc1)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C24H23NOS/c1-18(2)25(24(27)21-16-10-5-11-17-21)23(26)22(19-12-6-3-7-13-19)20-14-8-4-9-15-20/h3-18,22H,1-2H3 |
| InChIKey | BYDZPPCESQYRKX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|