C20H21Cl2N3 — CID 10714425
6-chloro-1-[(3-chlorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzimidazole (PubChem CID 10714425) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 6-chloro-1-[(3-chlorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzimidazole.
| Compound Name | 6-chloro-1-[(3-chlorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzimidazole |
|---|---|
| PubChem CID | 10714425 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-chloro-1-[(3-chlorophenyl)methyl]-2-(4-methylpiperidin-1-yl)benzimidazole |
| SMILES | CC1CCN(c2nc3ccc(Cl)cc3n2Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21Cl2N3/c1-14-7-9-24(10-8-14)20-23-18-6-5-17(22)12-19(18)25(20)13-15-3-2-4-16(21)11-15/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | SXAHSSWNWWSAPF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |