C11H21F3N2O — CID 107144500
(2S)-2-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 107144500) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is (2S)-2-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (2S)-2-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 107144500 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2S)-2-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CCCC[C@H](N)C(=O)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H21F3N2O/c1-4-5-6-9(15)10(17)16(8(2)3)7-11(12,13)14/h8-9H,4-7,15H2,1-3H3/t9-/m0/s1 |
| InChIKey | WHEPXZLNGGLPKX-VIFPVBQESA-N |
| XLogP | 2.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |