About 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate
4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate (PubChem CID 10714474) has the molecular formula C22H34N2O3
and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate |
| PubChem CID | 10714474 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate |
| SMILES | CC(C)(C)CNC(=O)N1CCCC[C@H]1C(=O)OCCCCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O3/c1-22(2,3)17-23-21(26)24-15-9-7-14-19(24)20(25)27-16-10-8-13-18-11-5-4-6-12-18/h4-6,11-12,19H,7-10,13-17H2,1-3H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | URCLAPJDGVZELV-IBGZPJMESA-N |
| XLogP | 4.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate?
The IUPAC name of 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate (CID 10714474) is 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate.
What is the SMILES notation for 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate?
The canonical SMILES for 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate is CC(C)(C)CNC(=O)N1CCCC[C@H]1C(=O)OCCCCc1ccccc1.
What is the InChIKey of 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate?
The InChIKey is URCLAPJDGVZELV-IBGZPJMESA-N. The full InChI is InChI=1S/C22H34N2O3/c1-22(2,3)17-23-21(26)24-15-9-7-14-19(24)20(25)27-16-10-8-13-18-11-5-4-6-12-18/h4-6,11-12,19H,7-10,13-17H2,1-3H3,(H,23,26)/t19-/m0/s1.
What are the key properties of 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate?
4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate has a molecular weight of 374.53 g/mol, XLogP of 4.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutyl (2S)-1-(2,2-dimethylpropylcarbamoyl)piperidine-2-carboxylate is sourced from PubChem (CID 10714474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).