C15H22N2O3 — CID 107145420
3-[[(2S)-2-aminohexanoyl]amino]-2-phenylpropanoic acid (PubChem CID 107145420) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-[[(2S)-2-aminohexanoyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[(2S)-2-aminohexanoyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 107145420 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-[[(2S)-2-aminohexanoyl]amino]-2-phenylpropanoic acid |
| SMILES | CCCC[C@H](N)C(=O)NCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-9-13(16)14(18)17-10-12(15(19)20)11-7-5-4-6-8-11/h4-8,12-13H,2-3,9-10,16H2,1H3,(H,17,18)(H,19,20)/t12?,13-/m0/s1 |
| InChIKey | IDBHRKSGJQBRRX-ABLWVSNPSA-N |
| XLogP | 1.49 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |