C14H20N2O4 — CID 107145552
3-[[(2S)-2-aminohexanoyl]amino]-4-methoxybenzoic acid (PubChem CID 107145552) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[[(2S)-2-aminohexanoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(2S)-2-aminohexanoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 107145552 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[[(2S)-2-aminohexanoyl]amino]-4-methoxybenzoic acid |
| SMILES | CCCC[C@H](N)C(=O)Nc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-3-4-5-10(15)13(17)16-11-8-9(14(18)19)6-7-12(11)20-2/h6-8,10H,3-5,15H2,1-2H3,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | ZDCGXPDMZHXDOL-JTQLQIEISA-N |
| XLogP | 1.85 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |