C21H23F3OSi — CID 10714568
[(1E,4E)-1,5-diphenyl-3-(trifluoromethyl)penta-1,4-dien-3-yl]oxy-trimethylsilane (PubChem CID 10714568) has the molecular formula C21H23F3OSi and a molecular weight of 376.49 g/mol. Its IUPAC name is [(1E,4E)-1,5-diphenyl-3-(trifluoromethyl)penta-1,4-dien-3-yl]oxy-trimethylsilane.
| Compound Name | [(1E,4E)-1,5-diphenyl-3-(trifluoromethyl)penta-1,4-dien-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10714568 |
| Molecular Formula | C21H23F3OSi |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1E,4E)-1,5-diphenyl-3-(trifluoromethyl)penta-1,4-dien-3-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC(/C=C/c1ccccc1)(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H23F3OSi/c1-26(2,3)25-20(21(22,23)24,16-14-18-10-6-4-7-11-18)17-15-19-12-8-5-9-13-19/h4-17H,1-3H3/b16-14+,17-15+ |
| InChIKey | UOWJHFQISDAHEA-YXLFCKQPSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|