C16H24N2O3 — CID 107145758
(2S)-2-[1-(4-methylphenyl)ethylcarbamoylamino]hexanoic acid (PubChem CID 107145758) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S)-2-[1-(4-methylphenyl)ethylcarbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[1-(4-methylphenyl)ethylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107145758 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2S)-2-[1-(4-methylphenyl)ethylcarbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)NC(C)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O3/c1-4-5-6-14(15(19)20)18-16(21)17-12(3)13-9-7-11(2)8-10-13/h7-10,12,14H,4-6H2,1-3H3,(H,19,20)(H2,17,18,21)/t12?,14-/m0/s1 |
| InChIKey | NURZSUBRQQTCDD-PYMCNQPYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |