C14H19BrN2O4 — CID 107146231
(2S)-2-[(2-bromo-5-methoxyphenyl)carbamoylamino]hexanoic acid (PubChem CID 107146231) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is (2S)-2-[(2-bromo-5-methoxyphenyl)carbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[(2-bromo-5-methoxyphenyl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107146231 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (2S)-2-[(2-bromo-5-methoxyphenyl)carbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)Nc1cc(OC)ccc1Br)C(=O)O |
| InChI | InChI=1S/C14H19BrN2O4/c1-3-4-5-11(13(18)19)16-14(20)17-12-8-9(21-2)6-7-10(12)15/h6-8,11H,3-5H2,1-2H3,(H,18,19)(H2,16,17,20)/t11-/m0/s1 |
| InChIKey | MMWHBYZVSYGEFB-NSHDSACASA-N |
| XLogP | 3.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |