C14H27N3O4 — CID 107146485
(2S)-2-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 107146485) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107146485 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-2-[[1-(tert-butylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)NC(C)C(=O)NC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N3O4/c1-6-7-8-10(12(19)20)16-13(21)15-9(2)11(18)17-14(3,4)5/h9-10H,6-8H2,1-5H3,(H,17,18)(H,19,20)(H2,15,16,21)/t9?,10-/m0/s1 |
| InChIKey | XDRKXTPHGCRGAA-AXDSSHIGSA-N |
| XLogP | 1.23 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |