C20H18N3O5+ — CID 10714732
3-(2,5-dimethylphenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one (PubChem CID 10714732) has the molecular formula C20H18N3O5+ and a molecular weight of 380.38 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-(2,5-dimethylphenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10714732 |
| Molecular Formula | C20H18N3O5+ |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one |
| SMILES | Cc1ccc(C)c(-[n+]2[nH]oc(=O)c2C(=O)CC2(O)C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C20H17N3O5/c1-11-7-8-12(2)15(9-11)23-17(18(25)28-22-23)16(24)10-20(27)13-5-3-4-6-14(13)21-19(20)26/h3-9,27H,10H2,1-2H3,(H-,21,22,24,25,26)/p+1 |
| InChIKey | ZGSXRXHKVHNEHM-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|