About ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate
ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate (PubChem CID 10714932) has the molecular formula C24H30O4
and a molecular weight of 382.50 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate |
| PubChem CID | 10714932 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate |
| SMILES | CCOC(=O)CC1(OCC)CCC(c2ccc(C)cc2)(c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C24H30O4/c1-5-26-22(25)17-23(27-6-2)15-16-24(28-23,20-11-7-18(3)8-12-20)21-13-9-19(4)10-14-21/h7-14H,5-6,15-17H2,1-4H3 |
| InChIKey | STGRJYYOFZGNHU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate?
The IUPAC name of ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate (CID 10714932) is ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate.
What is the SMILES notation for ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate?
The canonical SMILES for ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate is CCOC(=O)CC1(OCC)CCC(c2ccc(C)cc2)(c2ccc(C)cc2)O1.
What is the InChIKey of ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate?
The InChIKey is STGRJYYOFZGNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O4/c1-5-26-22(25)17-23(27-6-2)15-16-24(28-23,20-11-7-18(3)8-12-20)21-13-9-19(4)10-14-21/h7-14H,5-6,15-17H2,1-4H3.
What are the key properties of ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate?
ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate has a molecular weight of 382.50 g/mol, XLogP of 5.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-ethoxy-5,5-bis(4-methylphenyl)oxolan-2-yl]acetate is sourced from PubChem (CID 10714932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).