C14H19NO — CID 107149440
N-(2-cyclopropylethyl)-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 107149440) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | N-(2-cyclopropylethyl)-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 107149440 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(2-cyclopropylethyl)-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | c1ccc2c(c1)COCC2NCCC1CC1 |
| InChI | InChI=1S/C14H19NO/c1-2-4-13-12(3-1)9-16-10-14(13)15-8-7-11-5-6-11/h1-4,11,14-15H,5-10H2 |
| InChIKey | DYHFJDMZDKDSQW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |