C23H27ClN2O — CID 10714960
4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide (PubChem CID 10714960) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10714960 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H27ClN2O/c1-3-26(4-2)23(27)20-7-5-17(6-8-20)22(19-13-15-25-16-14-19)18-9-11-21(24)12-10-18/h5-12,25H,3-4,13-16H2,1-2H3 |
| InChIKey | HTVVGBNPROJDLV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |