About 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide
4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide (PubChem CID 10714960) has the molecular formula C23H27ClN2O
and a molecular weight of 382.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
| PubChem CID | 10714960 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H27ClN2O/c1-3-26(4-2)23(27)20-7-5-17(6-8-20)22(19-13-15-25-16-14-19)18-9-11-21(24)12-10-18/h5-12,25H,3-4,13-16H2,1-2H3 |
| InChIKey | HTVVGBNPROJDLV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide?
The IUPAC name of 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide (CID 10714960) is 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide.
What is the SMILES notation for 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide?
The canonical SMILES for 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide is CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccc(Cl)cc2)cc1.
What is the InChIKey of 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide?
The InChIKey is HTVVGBNPROJDLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27ClN2O/c1-3-26(4-2)23(27)20-7-5-17(6-8-20)22(19-13-15-25-16-14-19)18-9-11-21(24)12-10-18/h5-12,25H,3-4,13-16H2,1-2H3.
What are the key properties of 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide?
4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide has a molecular weight of 382.94 g/mol, XLogP of 5.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chlorophenyl)-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide is sourced from PubChem (CID 10714960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).