C18H17N5O3S — CID 10714976
5-imino-2,4-bis(4-methoxyphenyl)-3-sulfanylidene-1,2,4-triazine-6-carboxamide (PubChem CID 10714976) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 5-imino-2,4-bis(4-methoxyphenyl)-3-sulfanylidene-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-imino-2,4-bis(4-methoxyphenyl)-3-sulfanylidene-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 10714976 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-imino-2,4-bis(4-methoxyphenyl)-3-sulfanylidene-1,2,4-triazine-6-carboxamide |
| SMILES | [H]/N=c1\c(C(N)=O)nn(-c2ccc(OC)cc2)c(=S)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-25-13-7-3-11(4-8-13)22-16(19)15(17(20)24)21-23(18(22)27)12-5-9-14(26-2)10-6-12/h3-10,19H,1-2H3,(H2,20,24)/b19-16+ |
| InChIKey | OXHIJHYIXPROEU-KNTRCKAVSA-N |
| XLogP | 1.99 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|