About methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate
methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate (PubChem CID 107149902) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate |
| PubChem CID | 107149902 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate |
| SMILES | COC(=O)C1(NCCCN=[N+]=[N-])COCc2ccccc21 |
| InChI | InChI=1S/C14H18N4O3/c1-20-13(19)14(16-7-4-8-17-18-15)10-21-9-11-5-2-3-6-12(11)14/h2-3,5-6,16H,4,7-10H2,1H3 |
| InChIKey | SSSSWCDTBQWYTE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate?
The IUPAC name of methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate (CID 107149902) is methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate.
What is the SMILES notation for methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate?
The canonical SMILES for methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate is COC(=O)C1(NCCCN=[N+]=[N-])COCc2ccccc21.
What is the InChIKey of methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate?
The InChIKey is SSSSWCDTBQWYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c1-20-13(19)14(16-7-4-8-17-18-15)10-21-9-11-5-2-3-6-12(11)14/h2-3,5-6,16H,4,7-10H2,1H3.
What are the key properties of methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate?
methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate has a molecular weight of 290.32 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-azidopropylamino)-1,3-dihydroisochromene-4-carboxylate is sourced from PubChem (CID 107149902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).