About N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine
N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine (PubChem CID 107150183) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine.
Molecular Properties
| Compound Name | N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine |
| PubChem CID | 107150183 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine |
| SMILES | CC(C)NCC1CC12COCc1ccccc12 |
| InChI | InChI=1S/C15H21NO/c1-11(2)16-8-13-7-15(13)10-17-9-12-5-3-4-6-14(12)15/h3-6,11,13,16H,7-10H2,1-2H3 |
| InChIKey | LYSMTRBMFHBPAH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine?
The IUPAC name of N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine (CID 107150183) is N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine.
What is the SMILES notation for N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine?
The canonical SMILES for N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine is CC(C)NCC1CC12COCc1ccccc12.
What is the InChIKey of N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine?
The InChIKey is LYSMTRBMFHBPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-11(2)16-8-13-7-15(13)10-17-9-12-5-3-4-6-14(12)15/h3-6,11,13,16H,7-10H2,1-2H3.
What are the key properties of N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine?
N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine has a molecular weight of 231.34 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(spiro[1,3-dihydroisochromene-4,2'-cyclopropane]-1'-ylmethyl)propan-2-amine is sourced from PubChem (CID 107150183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).