About 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene
4-(1-chloroethyl)-3,4-dihydro-1H-isochromene (PubChem CID 107150369) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 107150369 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene |
| SMILES | CC(Cl)C1COCc2ccccc21 |
| InChI | InChI=1S/C11H13ClO/c1-8(12)11-7-13-6-9-4-2-3-5-10(9)11/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | VKQFFHLZVQCVSF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene (CID 107150369) is 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene is CC(Cl)C1COCc2ccccc21.
What is the InChIKey of 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene?
The InChIKey is VKQFFHLZVQCVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-8(12)11-7-13-6-9-4-2-3-5-10(9)11/h2-5,8,11H,6-7H2,1H3.
What are the key properties of 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene?
4-(1-chloroethyl)-3,4-dihydro-1H-isochromene has a molecular weight of 196.68 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 107150369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).