C11H13ClO — CID 107150369
4-(1-chloroethyl)-3,4-dihydro-1H-isochromene (PubChem CID 107150369) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene.
| Compound Name | 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 107150369 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-(1-chloroethyl)-3,4-dihydro-1H-isochromene |
| SMILES | CC(Cl)C1COCc2ccccc21 |
| InChI | InChI=1S/C11H13ClO/c1-8(12)11-7-13-6-9-4-2-3-5-10(9)11/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | VKQFFHLZVQCVSF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|