C20H38O5Si — CID 10715212
ethyl (2S,3aR,6aS)-2-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxylate (PubChem CID 10715212) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is ethyl (2S,3aR,6aS)-2-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxylate.
| Compound Name | ethyl (2S,3aR,6aS)-2-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxylate |
|---|---|
| PubChem CID | 10715212 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethyl (2S,3aR,6aS)-2-[3-[tert-butyl(dimethyl)silyl]oxypropoxymethyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@@H]1O[C@H](COCCCO[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C20H38O5Si/c1-7-23-18(21)20-11-8-10-17(20)25-16(14-20)15-22-12-9-13-24-26(5,6)19(2,3)4/h16-17H,7-15H2,1-6H3/t16-,17-,20+/m0/s1 |
| InChIKey | WKFIVDNECCVGGN-ABSDTBQOSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|