C17H7F6NO3 — CID 10715230
2-[3,5-bis(trifluoromethyl)phenyl]isoquinoline-1,3,4-trione (PubChem CID 10715230) has the molecular formula C17H7F6NO3 and a molecular weight of 387.24 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]isoquinoline-1,3,4-trione.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]isoquinoline-1,3,4-trione |
|---|---|
| PubChem CID | 10715230 |
| Molecular Formula | C17H7F6NO3 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]isoquinoline-1,3,4-trione |
| SMILES | O=C1C(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H7F6NO3/c18-16(19,20)8-5-9(17(21,22)23)7-10(6-8)24-14(26)12-4-2-1-3-11(12)13(25)15(24)27/h1-7H |
| InChIKey | LKOVZWXJYMCQSY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|