C21H24O2Se — CID 10715235
(3R,3aR,6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-3-phenylselanyl-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 10715235) has the molecular formula C21H24O2Se and a molecular weight of 387.38 g/mol. Its IUPAC name is (3R,3aR,6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-3-phenylselanyl-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3R,3aR,6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-3-phenylselanyl-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 10715235 |
| Molecular Formula | C21H24O2Se |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (3R,3aR,6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-3-phenylselanyl-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(C)=CC[C@@H]3[C@H](OC(=O)[C@]3(C)[Se]c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C21H24O2Se/c1-13-10-12-17-19(18-14(2)9-11-16(13)18)23-20(22)21(17,3)24-15-7-5-4-6-8-15/h4-8,10,16-19H,2,9,11-12H2,1,3H3/t16-,17+,18-,19-,21+/m0/s1 |
| InChIKey | MDSIESAJPJPWPK-FIRLOTFOSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|