C12H26N2O2 — CID 107152773
2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-methylbutanamide (PubChem CID 107152773) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-methylbutanamide.
| Compound Name | 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 107152773 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2-methylbutanamide |
| SMILES | CCC(C)(N)C(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-6-12(5,13)10(16)14-8-9(15)7-11(2,3)4/h9,15H,6-8,13H2,1-5H3,(H,14,16) |
| InChIKey | SBLGYTFPKJUERQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |