About 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one
3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one (PubChem CID 107153160) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one |
| PubChem CID | 107153160 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one |
| SMILES | CC(C)(C)CC(O)CNc1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)9-12(19)10-17-14-8-11-6-4-5-7-13(11)15(20)18-14/h4-8,12,19H,9-10H2,1-3H3,(H2,17,18,20) |
| InChIKey | KGNVCBUYPNKMLW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one?
The IUPAC name of 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one (CID 107153160) is 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one.
What is the SMILES notation for 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one?
The canonical SMILES for 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one is CC(C)(C)CC(O)CNc1cc2ccccc2c(=O)[nH]1.
What is the InChIKey of 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one?
The InChIKey is KGNVCBUYPNKMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-16(2,3)9-12(19)10-17-14-8-11-6-4-5-7-13(11)15(20)18-14/h4-8,12,19H,9-10H2,1-3H3,(H2,17,18,20).
What are the key properties of 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one?
3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one has a molecular weight of 274.36 g/mol, XLogP of 2.74, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydroxy-4,4-dimethylpentyl)amino]-2H-isoquinolin-1-one is sourced from PubChem (CID 107153160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).