C13H19N3O4 — CID 107153458
3-[(2-hydroxy-4-methylpentyl)amino]-4-nitrobenzamide (PubChem CID 107153458) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(2-hydroxy-4-methylpentyl)amino]-4-nitrobenzamide.
| Compound Name | 3-[(2-hydroxy-4-methylpentyl)amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 107153458 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-[(2-hydroxy-4-methylpentyl)amino]-4-nitrobenzamide |
| SMILES | CC(C)CC(O)CNc1cc(C(N)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O4/c1-8(2)5-10(17)7-15-11-6-9(13(14)18)3-4-12(11)16(19)20/h3-4,6,8,10,15,17H,5,7H2,1-2H3,(H2,14,18) |
| InChIKey | AXSOBTLLVUTDJC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|