C12H21F3N2OS — CID 107154414
5-(2,2-dimethylpropyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107154414) has the molecular formula C12H21F3N2OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-dimethylpropyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107154414 |
| Molecular Formula | C12H21F3N2OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)CC1CN=C(NCCOCC(F)(F)F)S1 |
| InChI | InChI=1S/C12H21F3N2OS/c1-11(2,3)6-9-7-17-10(19-9)16-4-5-18-8-12(13,14)15/h9H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | IKVYQJATVNQOQN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|