C16H30N2S — CID 107154544
5-(2,2-dimethylpropyl)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107154544) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-dimethylpropyl)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107154544 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)CC1CN=C(NCC2C(C)(C)C2(C)C)S1 |
| InChI | InChI=1S/C16H30N2S/c1-14(2,3)8-11-9-17-13(19-11)18-10-12-15(4,5)16(12,6)7/h11-12H,8-10H2,1-7H3,(H,17,18) |
| InChIKey | MFUUFOQTEPRSAI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |