C26H34OSi — CID 10715456
tert-butyl-[(4E,6E)-7-methylnona-4,6,8-trienoxy]-diphenylsilane (PubChem CID 10715456) has the molecular formula C26H34OSi and a molecular weight of 390.64 g/mol. Its IUPAC name is tert-butyl-[(4E,6E)-7-methylnona-4,6,8-trienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4E,6E)-7-methylnona-4,6,8-trienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10715456 |
| Molecular Formula | C26H34OSi |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl-[(4E,6E)-7-methylnona-4,6,8-trienoxy]-diphenylsilane |
| SMILES | C=C/C(C)=C/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34OSi/c1-6-23(2)17-11-7-8-16-22-27-28(26(3,4)5,24-18-12-9-13-19-24)25-20-14-10-15-21-25/h6-7,9-15,17-21H,1,8,16,22H2,2-5H3/b11-7+,23-17+ |
| InChIKey | SMWWINGDTVPNAX-DHMUVAAVSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|