C18H34N2S — CID 107154684
5-(2,2-dimethylpropyl)-N-(3,3,5,5-tetramethylcyclohexyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107154684) has the molecular formula C18H34N2S and a molecular weight of 310.55 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-(3,3,5,5-tetramethylcyclohexyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-dimethylpropyl)-N-(3,3,5,5-tetramethylcyclohexyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107154684 |
| Molecular Formula | C18H34N2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-(3,3,5,5-tetramethylcyclohexyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)CC1CN=C(NC2CC(C)(C)CC(C)(C)C2)S1 |
| InChI | InChI=1S/C18H34N2S/c1-16(2,3)10-14-11-19-15(21-14)20-13-8-17(4,5)12-18(6,7)9-13/h13-14H,8-12H2,1-7H3,(H,19,20) |
| InChIKey | RTJLLRUATFFFMS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |