C22H22FN5O — CID 10715484
7-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-12-methoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 10715484) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is 7-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-12-methoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-12-methoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 10715484 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 7-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-12-methoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nc(N3CCN(Cc4ccc(F)cc4)CC3)c3cccn3c2n1 |
| InChI | InChI=1S/C22H22FN5O/c1-29-20-9-8-18-21(25-20)28-10-2-3-19(28)22(24-18)27-13-11-26(12-14-27)15-16-4-6-17(23)7-5-16/h2-10H,11-15H2,1H3 |
| InChIKey | ARCIIEQRTPPAQU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |