About N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide
N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 107155272) has the molecular formula C14H21N3O2S
and a molecular weight of 295.41 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| PubChem CID | 107155272 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | Cc1cn2c(CC(=O)NCC(O)CC(C)C)csc2n1 |
| InChI | InChI=1S/C14H21N3O2S/c1-9(2)4-12(18)6-15-13(19)5-11-8-20-14-16-10(3)7-17(11)14/h7-9,12,18H,4-6H2,1-3H3,(H,15,19) |
| InChIKey | MATMOWRQCOBDLZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The IUPAC name of N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (CID 107155272) is N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
What is the SMILES notation for N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The canonical SMILES for N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide is Cc1cn2c(CC(=O)NCC(O)CC(C)C)csc2n1.
What is the InChIKey of N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The InChIKey is MATMOWRQCOBDLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2S/c1-9(2)4-12(18)6-15-13(19)5-11-8-20-14-16-10(3)7-17(11)14/h7-9,12,18H,4-6H2,1-3H3,(H,15,19).
What are the key properties of N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide has a molecular weight of 295.41 g/mol, XLogP of 1.77, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4-methylpentyl)-2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide is sourced from PubChem (CID 107155272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).