C17H23NO3 — CID 107155469
2-(2-hydroxy-4,4-dimethylpentyl)-4,7-dimethylisoindole-1,3-dione (PubChem CID 107155469) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(2-hydroxy-4,4-dimethylpentyl)-4,7-dimethylisoindole-1,3-dione.
| Compound Name | 2-(2-hydroxy-4,4-dimethylpentyl)-4,7-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 107155469 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(2-hydroxy-4,4-dimethylpentyl)-4,7-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)N(CC(O)CC(C)(C)C)C2=O |
| InChI | InChI=1S/C17H23NO3/c1-10-6-7-11(2)14-13(10)15(20)18(16(14)21)9-12(19)8-17(3,4)5/h6-7,12,19H,8-9H2,1-5H3 |
| InChIKey | OAFGUPWUIGMLFV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|