C13H21NO3 — CID 107155503
1-(2-hydroxy-4,4-dimethylpentyl)-3,4-dimethylpyrrole-2,5-dione (PubChem CID 107155503) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(2-hydroxy-4,4-dimethylpentyl)-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxy-4,4-dimethylpentyl)-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 107155503 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(2-hydroxy-4,4-dimethylpentyl)-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(CC(O)CC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H21NO3/c1-8-9(2)12(17)14(11(8)16)7-10(15)6-13(3,4)5/h10,15H,6-7H2,1-5H3 |
| InChIKey | JZSWFYJUUOOHJJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|