C10H15ClF3N3S — CID 107156164
N-(2-chloro-4,4-dimethylpentyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 107156164) has the molecular formula C10H15ClF3N3S and a molecular weight of 301.77 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107156164 |
| Molecular Formula | C10H15ClF3N3S |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(C)CC(Cl)CNc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H15ClF3N3S/c1-9(2,3)4-6(11)5-15-8-17-16-7(18-8)10(12,13)14/h6H,4-5H2,1-3H3,(H,15,17) |
| InChIKey | SYDKQHKNZQJRCJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|