C16H24BrNOS — CID 107156476
N-(2-bromo-4,4-dimethylpentyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 107156476) has the molecular formula C16H24BrNOS and a molecular weight of 358.35 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107156476 |
| Molecular Formula | C16H24BrNOS |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)CC(Br)CNC(=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C16H24BrNOS/c1-16(2,3)9-12(17)10-18-15(19)14-8-11-6-4-5-7-13(11)20-14/h8,12H,4-7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | CECQXGZIOOQOEV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|