C14H19Br2NO — CID 107157706
3-bromo-N-(2-bromo-4-methylpentyl)-4-methylbenzamide (PubChem CID 107157706) has the molecular formula C14H19Br2NO and a molecular weight of 377.12 g/mol. Its IUPAC name is 3-bromo-N-(2-bromo-4-methylpentyl)-4-methylbenzamide.
| Compound Name | 3-bromo-N-(2-bromo-4-methylpentyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 107157706 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-bromo-N-(2-bromo-4-methylpentyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(Br)CC(C)C)cc1Br |
| InChI | InChI=1S/C14H19Br2NO/c1-9(2)6-12(15)8-17-14(18)11-5-4-10(3)13(16)7-11/h4-5,7,9,12H,6,8H2,1-3H3,(H,17,18) |
| InChIKey | ODILPSSZUZMMME-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|