C20H20N4O3S — CID 10715771
5-[[4-[(3,5,7-trimethylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10715771) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 5-[[4-[(3,5,7-trimethylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(3,5,7-trimethylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10715771 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 5-[[4-[(3,5,7-trimethylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C)c2nc(COc3ccc(CC4SC(=O)NC4=O)cc3)n(C)c2n1 |
| InChI | InChI=1S/C20H20N4O3S/c1-11-8-12(2)21-18-17(11)22-16(24(18)3)10-27-14-6-4-13(5-7-14)9-15-19(25)23-20(26)28-15/h4-8,15H,9-10H2,1-3H3,(H,23,25,26) |
| InChIKey | XMKZTZAAXUJJBA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|