C14H23N3O — CID 107158461
N-(2-amino-4,4-dimethylpentyl)-5-methylpyridine-3-carboxamide (PubChem CID 107158461) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2-amino-4,4-dimethylpentyl)-5-methylpyridine-3-carboxamide.
| Compound Name | N-(2-amino-4,4-dimethylpentyl)-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 107158461 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(2-amino-4,4-dimethylpentyl)-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)NCC(N)CC(C)(C)C)c1 |
| InChI | InChI=1S/C14H23N3O/c1-10-5-11(8-16-7-10)13(18)17-9-12(15)6-14(2,3)4/h5,7-8,12H,6,9,15H2,1-4H3,(H,17,18) |
| InChIKey | ZFPQKVHSZAEVNS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |