C15H24N2O3 — CID 107158831
N-(2-amino-4-methylpentyl)-2,5-dimethoxybenzamide (PubChem CID 107158831) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(2-amino-4-methylpentyl)-2,5-dimethoxybenzamide.
| Compound Name | N-(2-amino-4-methylpentyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 107158831 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-(2-amino-4-methylpentyl)-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NCC(N)CC(C)C)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-10(2)7-11(16)9-17-15(18)13-8-12(19-3)5-6-14(13)20-4/h5-6,8,10-11H,7,9,16H2,1-4H3,(H,17,18) |
| InChIKey | UBGHDQRPZLTKTA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |