C14H24N4O — CID 107159414
4-[(2-amino-4-methylpentyl)amino]-N-ethylpyridine-2-carboxamide (PubChem CID 107159414) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-[(2-amino-4-methylpentyl)amino]-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-[(2-amino-4-methylpentyl)amino]-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 107159414 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-[(2-amino-4-methylpentyl)amino]-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(NCC(N)CC(C)C)ccn1 |
| InChI | InChI=1S/C14H24N4O/c1-4-16-14(19)13-8-12(5-6-17-13)18-9-11(15)7-10(2)3/h5-6,8,10-11H,4,7,9,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | RRTLHKXSBSPOBL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |