C11H22N2O — CID 107160042
1-[4-(aminomethyl)-4-methylpiperidin-1-yl]-2-methylpropan-1-one (PubChem CID 107160042) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-4-methylpiperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-(aminomethyl)-4-methylpiperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 107160042 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-[4-(aminomethyl)-4-methylpiperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC(C)(CN)CC1 |
| InChI | InChI=1S/C11H22N2O/c1-9(2)10(14)13-6-4-11(3,8-12)5-7-13/h9H,4-8,12H2,1-3H3 |
| InChIKey | OYTMBDXEBSLKRU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |