C22H29NO6 — CID 10716149
(2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]oxane-3,4-diol (PubChem CID 10716149) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 10716149 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2S,3R,4R,5S)-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]oxane-3,4-diol |
| SMILES | C[C@H]([C@@H]1O[C@H]1C[C@H]1CO[C@@H](Cc2cc(-c3ccccc3)on2)[C@H](O)[C@@H]1O)[C@H](C)O |
| InChI | InChI=1S/C22H29NO6/c1-12(13(2)24)22-19(28-22)8-15-11-27-18(21(26)20(15)25)10-16-9-17(29-23-16)14-6-4-3-5-7-14/h3-7,9,12-13,15,18-22,24-26H,8,10-11H2,1-2H3/t12-,13-,15-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | ZENQTNUVTQLMEQ-MRQXEPQISA-N |
| XLogP | 1.80 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|