C16H21N5 — CID 107162205
4-methyl-1-(3-methylquinoxalin-2-yl)piperidine-4-carboximidamide (PubChem CID 107162205) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-methyl-1-(3-methylquinoxalin-2-yl)piperidine-4-carboximidamide.
| Compound Name | 4-methyl-1-(3-methylquinoxalin-2-yl)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162205 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-methyl-1-(3-methylquinoxalin-2-yl)piperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1(C)CCN(c2nc3ccccc3nc2C)CC1 |
| InChI | InChI=1S/C16H21N5/c1-11-14(20-13-6-4-3-5-12(13)19-11)21-9-7-16(2,8-10-21)15(17)18/h3-6H,7-10H2,1-2H3,(H3,17,18) |
| InChIKey | VIXWTCBYLJDCAK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|