C15H24N4O — CID 107162906
2,4-diamino-N-[(1,4-dimethylpiperidin-4-yl)methyl]benzamide (PubChem CID 107162906) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,4-diamino-N-[(1,4-dimethylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 2,4-diamino-N-[(1,4-dimethylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107162906 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2,4-diamino-N-[(1,4-dimethylpiperidin-4-yl)methyl]benzamide |
| SMILES | CN1CCC(C)(CNC(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C15H24N4O/c1-15(5-7-19(2)8-6-15)10-18-14(20)12-4-3-11(16)9-13(12)17/h3-4,9H,5-8,10,16-17H2,1-2H3,(H,18,20) |
| InChIKey | SZJJADINWURGIU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|