About N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide (PubChem CID 107163864) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide |
| PubChem CID | 107163864 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide |
| SMILES | CCC1(C(=O)NCC2(C)CCN(C)CC2)CCCN1 |
| InChI | InChI=1S/C15H29N3O/c1-4-15(6-5-9-17-15)13(19)16-12-14(2)7-10-18(3)11-8-14/h17H,4-12H2,1-3H3,(H,16,19) |
| InChIKey | BVACCKBMIFJCRA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide?
The IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide (CID 107163864) is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide?
The canonical SMILES for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide is CCC1(C(=O)NCC2(C)CCN(C)CC2)CCCN1.
What is the InChIKey of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide?
The InChIKey is BVACCKBMIFJCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O/c1-4-15(6-5-9-17-15)13(19)16-12-14(2)7-10-18(3)11-8-14/h17H,4-12H2,1-3H3,(H,16,19).
What are the key properties of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide?
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide has a molecular weight of 267.42 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethylpyrrolidine-2-carboxamide is sourced from PubChem (CID 107163864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).